C34H28F6N8O4 — CID 158317147
1-[3-(7-formylimidazo[1,2-a]pyridin-3-yl)phenyl]-3-(2,2,2-trifluoroethyl)urea;1-[3-[7-(hydroxymethyl)imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 158317147) has the molecular formula C34H28F6N8O4 and a molecular weight of 726.64 g/mol. Its IUPAC name is 1-[3-(7-formylimidazo[1,2-a]pyridin-3-yl)phenyl]-3-(2,2,2-trifluoroethyl)urea;1-[3-[7-(hydroxymethyl)imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[3-(7-formylimidazo[1,2-a]pyridin-3-yl)phenyl]-3-(2,2,2-trifluoroethyl)urea;1-[3-[7-(hydroxymethyl)imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 158317147 |
| Molecular Formula | C34H28F6N8O4 |
| Molecular Weight | 726.64 g/mol |
| Exact Mass | 726.21 |
| IUPAC Name | 1-[3-(7-formylimidazo[1,2-a]pyridin-3-yl)phenyl]-3-(2,2,2-trifluoroethyl)urea;1-[3-[7-(hydroxymethyl)imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | O=C(NCC(F)(F)F)Nc1cccc(-c2cnc3cc(CO)ccn23)c1.O=Cc1ccn2c(-c3cccc(NC(=O)NCC(F)(F)F)c3)cnc2c1 |
| InChI | InChI=1S/C17H15F3N4O2.C17H13F3N4O2/c2*18-17(19,20)10-22-16(26)23-13-3-1-2-12(7-13)14-8-21-15-6-11(9-25)4-5-24(14)15/h1-8,25H,9-10H2,(H2,22,23,26);1-9H,10H2,(H2,22,23,26) |
| InChIKey | GOJYIRHURTYQJS-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 154.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.64 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|