About 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;propan-1-amine
1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;propan-1-amine (PubChem CID 158317161) has the molecular formula C12H19NO4
and a molecular weight of 241.29 g/mol. Its IUPAC name is 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;propan-1-amine.
Molecular Properties
| Compound Name | 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;propan-1-amine |
| PubChem CID | 158317161 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;propan-1-amine |
| SMILES | CC1(C(=O)O)C=CC=C(C(=O)O)C1.CCCN |
| InChI | InChI=1S/C9H10O4.C3H9N/c1-9(8(12)13)4-2-3-6(5-9)7(10)11;1-2-3-4/h2-4H,5H2,1H3,(H,10,11)(H,12,13);2-4H2,1H3 |
| InChIKey | GOJYXRAGXWLIMO-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;propan-1-amine?
The IUPAC name of 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;propan-1-amine (CID 158317161) is 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;propan-1-amine.
What is the SMILES notation for 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;propan-1-amine?
The canonical SMILES for 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;propan-1-amine is CC1(C(=O)O)C=CC=C(C(=O)O)C1.CCCN.
What is the InChIKey of 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;propan-1-amine?
The InChIKey is GOJYXRAGXWLIMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O4.C3H9N/c1-9(8(12)13)4-2-3-6(5-9)7(10)11;1-2-3-4/h2-4H,5H2,1H3,(H,10,11)(H,12,13);2-4H2,1H3.
What are the key properties of 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;propan-1-amine?
1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;propan-1-amine has a molecular weight of 241.29 g/mol, XLogP of 1.40, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;propan-1-amine is sourced from PubChem (CID 158317161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).