C48H60Br4O8 — CID 15831767
5,11,17,23-tetrabromo-2,8,14,20-tetrapentylpentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15,17,19(26),21,23-dodecaene-4,6,10,12,16,18,22,24-octol (PubChem CID 15831767) has the molecular formula C48H60Br4O8 and a molecular weight of 1084.62 g/mol. Its IUPAC name is 5,11,17,23-tetrabromo-2,8,14,20-tetrapentylpentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15,17,19(26),21,23-dodecaene-4,6,10,12,16,18,22,24-octol.
| Compound Name | 5,11,17,23-tetrabromo-2,8,14,20-tetrapentylpentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15,17,19(26),21,23-dodecaene-4,6,10,12,16,18,22,24-octol |
|---|---|
| PubChem CID | 15831767 |
| Molecular Formula | C48H60Br4O8 |
| Molecular Weight | 1084.62 g/mol |
| Exact Mass | 1080.10 |
| IUPAC Name | 5,11,17,23-tetrabromo-2,8,14,20-tetrapentylpentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15,17,19(26),21,23-dodecaene-4,6,10,12,16,18,22,24-octol |
| SMILES | CCCCCC1c2cc(c(O)c(Br)c2O)C(CCCCC)c2cc(c(O)c(Br)c2O)C(CCCCC)c2cc(c(O)c(Br)c2O)C(CCCCC)c2cc1c(O)c(Br)c2O |
| InChI | InChI=1S/C48H60Br4O8/c1-5-9-13-17-25-29-21-31(43(55)37(49)41(29)53)26(18-14-10-6-2)33-23-35(47(59)39(51)45(33)57)28(20-16-12-8-4)36-24-34(46(58)40(52)48(36)60)27(19-15-11-7-3)32-22-30(25)42(54)38(50)44(32)56/h21-28,53-60H,5-20H2,1-4H3 |
| InChIKey | DBHBOIMXUKWKAQ-UHFFFAOYSA-N |
| XLogP | 15.54 |
| TPSA | 161.84 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1084.62 |
| LogP ≤ 5 | 15.54 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|