About O-(3-butan-2-ylphenyl) 2-(1-adamantyl)ethanethioate
O-(3-butan-2-ylphenyl) 2-(1-adamantyl)ethanethioate (PubChem CID 158318634) has the molecular formula C22H30OS
and a molecular weight of 342.55 g/mol. Its IUPAC name is O-(3-butan-2-ylphenyl) 2-(1-adamantyl)ethanethioate.
Molecular Properties
| Compound Name | O-(3-butan-2-ylphenyl) 2-(1-adamantyl)ethanethioate |
| PubChem CID | 158318634 |
| Molecular Formula | C22H30OS |
| Molecular Weight | 342.55 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | O-(3-butan-2-ylphenyl) 2-(1-adamantyl)ethanethioate |
| SMILES | CCC(C)c1cccc(OC(=S)CC23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C22H30OS/c1-3-15(2)19-5-4-6-20(10-19)23-21(24)14-22-11-16-7-17(12-22)9-18(8-16)13-22/h4-6,10,15-18H,3,7-9,11-14H2,1-2H3 |
| InChIKey | ATKICORMDPXSQF-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.55 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-(3-butan-2-ylphenyl) 2-(1-adamantyl)ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(3-butan-2-ylphenyl) 2-(1-adamantyl)ethanethioate?
The IUPAC name of O-(3-butan-2-ylphenyl) 2-(1-adamantyl)ethanethioate (CID 158318634) is O-(3-butan-2-ylphenyl) 2-(1-adamantyl)ethanethioate.
What is the SMILES notation for O-(3-butan-2-ylphenyl) 2-(1-adamantyl)ethanethioate?
The canonical SMILES for O-(3-butan-2-ylphenyl) 2-(1-adamantyl)ethanethioate is CCC(C)c1cccc(OC(=S)CC23CC4CC(CC(C4)C2)C3)c1.
What is the InChIKey of O-(3-butan-2-ylphenyl) 2-(1-adamantyl)ethanethioate?
The InChIKey is ATKICORMDPXSQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H30OS/c1-3-15(2)19-5-4-6-20(10-19)23-21(24)14-22-11-16-7-17(12-22)9-18(8-16)13-22/h4-6,10,15-18H,3,7-9,11-14H2,1-2H3.
What are the key properties of O-(3-butan-2-ylphenyl) 2-(1-adamantyl)ethanethioate?
O-(3-butan-2-ylphenyl) 2-(1-adamantyl)ethanethioate has a molecular weight of 342.55 g/mol, XLogP of 6.51, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for O-(3-butan-2-ylphenyl) 2-(1-adamantyl)ethanethioate is sourced from PubChem (CID 158318634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).