C33H68BNO5Si3 — CID 158318692
(7S)-7-[bis(trimethylsilyl)amino]-2-tert-butyl-3-[tert-butyl(dimethyl)silyl]oxy-7-[(1R,2R,6S,8R)-6,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]heptanoic acid (PubChem CID 158318692) has the molecular formula C33H68BNO5Si3 and a molecular weight of 653.98 g/mol. Its IUPAC name is (7S)-7-[bis(trimethylsilyl)amino]-2-tert-butyl-3-[tert-butyl(dimethyl)silyl]oxy-7-[(1R,2R,6S,8R)-6,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]heptanoic acid.
| Compound Name | (7S)-7-[bis(trimethylsilyl)amino]-2-tert-butyl-3-[tert-butyl(dimethyl)silyl]oxy-7-[(1R,2R,6S,8R)-6,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]heptanoic acid |
|---|---|
| PubChem CID | 158318692 |
| Molecular Formula | C33H68BNO5Si3 |
| Molecular Weight | 653.98 g/mol |
| Exact Mass | 653.45 |
| IUPAC Name | (7S)-7-[bis(trimethylsilyl)amino]-2-tert-butyl-3-[tert-butyl(dimethyl)silyl]oxy-7-[(1R,2R,6S,8R)-6,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]heptanoic acid |
| SMILES | CC(C)(C)C(C(=O)O)C(CCC[C@H](B1O[C@@H]2[C@@H]3C[C@H](C[C@]2(C)O1)C3(C)C)N([Si](C)(C)C)[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H68BNO5Si3/c1-30(2,3)27(29(36)37)25(39-43(16,17)31(4,5)6)19-18-20-26(35(41(10,11)12)42(13,14)15)34-38-28-24-21-23(32(24,7)8)22-33(28,9)40-34/h23-28H,18-22H2,1-17H3,(H,36,37)/t23-,24+,25?,26-,27?,28-,33+/m1/s1 |
| InChIKey | UHSPTNFTFYLQRF-UFGAWNBZSA-N |
| XLogP | 8.90 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.98 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|