About 4-aminoadamantan-1-ol;5-hydroxyadamantan-2-one;4-hydroxyiminoadamantan-1-ol
4-aminoadamantan-1-ol;5-hydroxyadamantan-2-one;4-hydroxyiminoadamantan-1-ol (PubChem CID 158318854) has the molecular formula C30H46N2O5
and a molecular weight of 514.71 g/mol. Its IUPAC name is 4-aminoadamantan-1-ol;5-hydroxyadamantan-2-one;4-hydroxyiminoadamantan-1-ol.
Molecular Properties
| Compound Name | 4-aminoadamantan-1-ol;5-hydroxyadamantan-2-one;4-hydroxyiminoadamantan-1-ol |
| PubChem CID | 158318854 |
| Molecular Formula | C30H46N2O5 |
| Molecular Weight | 514.71 g/mol |
| Exact Mass | 514.34 |
| IUPAC Name | 4-aminoadamantan-1-ol;5-hydroxyadamantan-2-one;4-hydroxyiminoadamantan-1-ol |
| SMILES | NC1C2CC3CC1CC(O)(C3)C2.O=C1C2CC3CC1CC(O)(C3)C2.ON=C1C2CC3CC1CC(O)(C3)C2 |
| InChI | InChI=1S/C10H15NO2.C10H17NO.C10H14O2/c12-10-3-6-1-7(4-10)9(11-13)8(2-6)5-10;2*11-9-7-1-6-2-8(9)5-10(12,3-6)4-7/h6-8,12-13H,1-5H2;6-9,12H,1-5,11H2;6-8,12H,1-5H2/b11-9-;; |
| InChIKey | GOPDIWFDFVBWKD-WSELPHFCSA-N |
| XLogP | 3.40 |
| TPSA | 136.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 514.71 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-aminoadamantan-1-ol;5-hydroxyadamantan-2-one;4-hydroxyiminoadamantan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminoadamantan-1-ol;5-hydroxyadamantan-2-one;4-hydroxyiminoadamantan-1-ol?
The IUPAC name of 4-aminoadamantan-1-ol;5-hydroxyadamantan-2-one;4-hydroxyiminoadamantan-1-ol (CID 158318854) is 4-aminoadamantan-1-ol;5-hydroxyadamantan-2-one;4-hydroxyiminoadamantan-1-ol.
What is the SMILES notation for 4-aminoadamantan-1-ol;5-hydroxyadamantan-2-one;4-hydroxyiminoadamantan-1-ol?
The canonical SMILES for 4-aminoadamantan-1-ol;5-hydroxyadamantan-2-one;4-hydroxyiminoadamantan-1-ol is NC1C2CC3CC1CC(O)(C3)C2.O=C1C2CC3CC1CC(O)(C3)C2.ON=C1C2CC3CC1CC(O)(C3)C2.
What is the InChIKey of 4-aminoadamantan-1-ol;5-hydroxyadamantan-2-one;4-hydroxyiminoadamantan-1-ol?
The InChIKey is GOPDIWFDFVBWKD-WSELPHFCSA-N. The full InChI is InChI=1S/C10H15NO2.C10H17NO.C10H14O2/c12-10-3-6-1-7(4-10)9(11-13)8(2-6)5-10;2*11-9-7-1-6-2-8(9)5-10(12,3-6)4-7/h6-8,12-13H,1-5H2;6-9,12H,1-5,11H2;6-8,12H,1-5H2/b11-9-;;.
What are the key properties of 4-aminoadamantan-1-ol;5-hydroxyadamantan-2-one;4-hydroxyiminoadamantan-1-ol?
4-aminoadamantan-1-ol;5-hydroxyadamantan-2-one;4-hydroxyiminoadamantan-1-ol has a molecular weight of 514.71 g/mol, XLogP of 3.40, 0 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminoadamantan-1-ol;5-hydroxyadamantan-2-one;4-hydroxyiminoadamantan-1-ol is sourced from PubChem (CID 158318854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).