C26H44F2O2 — CID 158319245
(3R,4E,7Z)-5-fluoro-2,3-dimethylundeca-4,7-dien-6-ol;(E,3R)-5-fluoro-2,3-dimethylundec-4-en-7-yn-6-ol (PubChem CID 158319245) has the molecular formula C26H44F2O2 and a molecular weight of 426.63 g/mol. Its IUPAC name is (3R,4E,7Z)-5-fluoro-2,3-dimethylundeca-4,7-dien-6-ol;(E,3R)-5-fluoro-2,3-dimethylundec-4-en-7-yn-6-ol.
| Compound Name | (3R,4E,7Z)-5-fluoro-2,3-dimethylundeca-4,7-dien-6-ol;(E,3R)-5-fluoro-2,3-dimethylundec-4-en-7-yn-6-ol |
|---|---|
| PubChem CID | 158319245 |
| Molecular Formula | C26H44F2O2 |
| Molecular Weight | 426.63 g/mol |
| Exact Mass | 426.33 |
| IUPAC Name | (3R,4E,7Z)-5-fluoro-2,3-dimethylundeca-4,7-dien-6-ol;(E,3R)-5-fluoro-2,3-dimethylundec-4-en-7-yn-6-ol |
| SMILES | CCC/C=C\C(O)/C(F)=C\[C@H](C)C(C)C.CCCC#CC(O)/C(F)=C\[C@H](C)C(C)C |
| InChI | InChI=1S/C13H23FO.C13H21FO/c2*1-5-6-7-8-13(15)12(14)9-11(4)10(2)3/h7-11,13,15H,5-6H2,1-4H3;9-11,13,15H,5-6H2,1-4H3/b8-7-,12-9+;12-9+/t2*11-,13?/m00/s1 |
| InChIKey | GOQGXSZCITTXEY-BGDWYHTMSA-N |
| XLogP | 7.15 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.63 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|