C23H30FN3O4 — CID 158320496
carbon dioxide;1-[2-(3-fluoro-6-pentoxy-1,5-naphthyridin-4-yl)ethyl]-2-oxabicyclo[2.2.2]octan-4-amine (PubChem CID 158320496) has the molecular formula C23H30FN3O4 and a molecular weight of 431.51 g/mol. Its IUPAC name is carbon dioxide;1-[2-(3-fluoro-6-pentoxy-1,5-naphthyridin-4-yl)ethyl]-2-oxabicyclo[2.2.2]octan-4-amine.
| Compound Name | carbon dioxide;1-[2-(3-fluoro-6-pentoxy-1,5-naphthyridin-4-yl)ethyl]-2-oxabicyclo[2.2.2]octan-4-amine |
|---|---|
| PubChem CID | 158320496 |
| Molecular Formula | C23H30FN3O4 |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | carbon dioxide;1-[2-(3-fluoro-6-pentoxy-1,5-naphthyridin-4-yl)ethyl]-2-oxabicyclo[2.2.2]octan-4-amine |
| SMILES | CCCCCOc1ccc2ncc(F)c(CCC34CCC(N)(CC3)CO4)c2n1.O=C=O |
| InChI | InChI=1S/C22H30FN3O2.CO2/c1-2-3-4-13-27-19-6-5-18-20(26-19)16(17(23)14-25-18)7-8-22-11-9-21(24,10-12-22)15-28-22;2-1-3/h5-6,14H,2-4,7-13,15,24H2,1H3; |
| InChIKey | GOUCKLDTQZYNSB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 104.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|