C40H46BN3 — CID 158320517
11-tert-butyl-8-ethyl-15,15-dimethyl-6-(1-methylcyclohexyl)-16-phenyl-8,14,16-triaza-1-borahexacyclo[11.8.1.114,17.02,7.09,22.021,23]tricosa-2(7),3,5,9(22),10,12,17,19,21(23)-nonaene (PubChem CID 158320517) has the molecular formula C40H46BN3 and a molecular weight of 579.64 g/mol. Its IUPAC name is 11-tert-butyl-8-ethyl-15,15-dimethyl-6-(1-methylcyclohexyl)-16-phenyl-8,14,16-triaza-1-borahexacyclo[11.8.1.114,17.02,7.09,22.021,23]tricosa-2(7),3,5,9(22),10,12,17,19,21(23)-nonaene.
| Compound Name | 11-tert-butyl-8-ethyl-15,15-dimethyl-6-(1-methylcyclohexyl)-16-phenyl-8,14,16-triaza-1-borahexacyclo[11.8.1.114,17.02,7.09,22.021,23]tricosa-2(7),3,5,9(22),10,12,17,19,21(23)-nonaene |
|---|---|
| PubChem CID | 158320517 |
| Molecular Formula | C40H46BN3 |
| Molecular Weight | 579.64 g/mol |
| Exact Mass | 579.38 |
| IUPAC Name | 11-tert-butyl-8-ethyl-15,15-dimethyl-6-(1-methylcyclohexyl)-16-phenyl-8,14,16-triaza-1-borahexacyclo[11.8.1.114,17.02,7.09,22.021,23]tricosa-2(7),3,5,9(22),10,12,17,19,21(23)-nonaene |
| SMILES | CCN1c2cc(C(C)(C)C)cc3c2B(c2cccc(C4(C)CCCCC4)c21)c1cccc2c1N3C(C)(C)N2c1ccccc1 |
| InChI | InChI=1S/C40H46BN3/c1-8-42-33-25-27(38(2,3)4)26-34-35(33)41(30-20-15-19-29(36(30)42)40(7)23-13-10-14-24-40)31-21-16-22-32-37(31)44(34)39(5,6)43(32)28-17-11-9-12-18-28/h9,11-12,15-22,25-26H,8,10,13-14,23-24H2,1-7H3 |
| InChIKey | GOUDZCAXYXECHL-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.64 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|