About (Z)-1-tert-butylsulfanyl-3,3-dimethylbut-1-ene;methane;yttrium
(Z)-1-tert-butylsulfanyl-3,3-dimethylbut-1-ene;methane;yttrium (PubChem CID 158321588) has the molecular formula C11H24SY
and a molecular weight of 277.29 g/mol. Its IUPAC name is (Z)-1-tert-butylsulfanyl-3,3-dimethylbut-1-ene;methane;yttrium.
Molecular Properties
| Compound Name | (Z)-1-tert-butylsulfanyl-3,3-dimethylbut-1-ene;methane;yttrium |
| PubChem CID | 158321588 |
| Molecular Formula | C11H24SY |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | (Z)-1-tert-butylsulfanyl-3,3-dimethylbut-1-ene;methane;yttrium |
| SMILES | C.CC(C)(C)/C=C\SC(C)(C)C.[Y] |
| InChI | InChI=1S/C10H20S.CH4.Y/c1-9(2,3)7-8-11-10(4,5)6;;/h7-8H,1-6H3;1H4;/b8-7-;; |
| InChIKey | GOXJYQBMZIXCPE-OTMFCZTRSA-N |
| XLogP | 4.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (Z)-1-tert-butylsulfanyl-3,3-dimethylbut-1-ene;methane;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-tert-butylsulfanyl-3,3-dimethylbut-1-ene;methane;yttrium?
The IUPAC name of (Z)-1-tert-butylsulfanyl-3,3-dimethylbut-1-ene;methane;yttrium (CID 158321588) is (Z)-1-tert-butylsulfanyl-3,3-dimethylbut-1-ene;methane;yttrium.
What is the SMILES notation for (Z)-1-tert-butylsulfanyl-3,3-dimethylbut-1-ene;methane;yttrium?
The canonical SMILES for (Z)-1-tert-butylsulfanyl-3,3-dimethylbut-1-ene;methane;yttrium is C.CC(C)(C)/C=C\SC(C)(C)C.[Y].
What is the InChIKey of (Z)-1-tert-butylsulfanyl-3,3-dimethylbut-1-ene;methane;yttrium?
The InChIKey is GOXJYQBMZIXCPE-OTMFCZTRSA-N. The full InChI is InChI=1S/C10H20S.CH4.Y/c1-9(2,3)7-8-11-10(4,5)6;;/h7-8H,1-6H3;1H4;/b8-7-;;.
What are the key properties of (Z)-1-tert-butylsulfanyl-3,3-dimethylbut-1-ene;methane;yttrium?
(Z)-1-tert-butylsulfanyl-3,3-dimethylbut-1-ene;methane;yttrium has a molecular weight of 277.29 g/mol, XLogP of 4.71, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-tert-butylsulfanyl-3,3-dimethylbut-1-ene;methane;yttrium is sourced from PubChem (CID 158321588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).