C11H5F6NO4 — CID 158321792
4-cyano-3-methyl-2,5-bis(trifluoromethoxy)benzoic acid (PubChem CID 158321792) has the molecular formula C11H5F6NO4 and a molecular weight of 329.15 g/mol. Its IUPAC name is 4-cyano-3-methyl-2,5-bis(trifluoromethoxy)benzoic acid.
| Compound Name | 4-cyano-3-methyl-2,5-bis(trifluoromethoxy)benzoic acid |
|---|---|
| PubChem CID | 158321792 |
| Molecular Formula | C11H5F6NO4 |
| Molecular Weight | 329.15 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | 4-cyano-3-methyl-2,5-bis(trifluoromethoxy)benzoic acid |
| SMILES | Cc1c(C#N)c(OC(F)(F)F)cc(C(=O)O)c1OC(F)(F)F |
| InChI | InChI=1S/C11H5F6NO4/c1-4-6(3-18)7(21-10(12,13)14)2-5(9(19)20)8(4)22-11(15,16)17/h2H,1H3,(H,19,20) |
| InChIKey | GOYBQQCPJTVDNW-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.15 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |