About 2,3-dimethyl-4,6-dihydrocyclopenta[b]pyridin-4-ide;ethane;yttrium
2,3-dimethyl-4,6-dihydrocyclopenta[b]pyridin-4-ide;ethane;yttrium (PubChem CID 158321972) has the molecular formula C12H16NY-
and a molecular weight of 263.17 g/mol. Its IUPAC name is 2,3-dimethyl-4,6-dihydrocyclopenta[b]pyridin-4-ide;ethane;yttrium.
Molecular Properties
| Compound Name | 2,3-dimethyl-4,6-dihydrocyclopenta[b]pyridin-4-ide;ethane;yttrium |
| PubChem CID | 158321972 |
| Molecular Formula | C12H16NY- |
| Molecular Weight | 263.17 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | 2,3-dimethyl-4,6-dihydrocyclopenta[b]pyridin-4-ide;ethane;yttrium |
| SMILES | CC.Cc1[c-]c2c(nc1C)=CCC=2.[Y] |
| InChI | InChI=1S/C10H10N.C2H6.Y/c1-7-6-9-4-3-5-10(9)11-8(7)2;1-2;/h4-5H,3H2,1-2H3;1-2H3;/q-1;; |
| InChIKey | NHKYHWJDUJCVDC-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.17 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethyl-4,6-dihydrocyclopenta[b]pyridin-4-ide;ethane;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-4,6-dihydrocyclopenta[b]pyridin-4-ide;ethane;yttrium?
The IUPAC name of 2,3-dimethyl-4,6-dihydrocyclopenta[b]pyridin-4-ide;ethane;yttrium (CID 158321972) is 2,3-dimethyl-4,6-dihydrocyclopenta[b]pyridin-4-ide;ethane;yttrium.
What is the SMILES notation for 2,3-dimethyl-4,6-dihydrocyclopenta[b]pyridin-4-ide;ethane;yttrium?
The canonical SMILES for 2,3-dimethyl-4,6-dihydrocyclopenta[b]pyridin-4-ide;ethane;yttrium is CC.Cc1[c-]c2c(nc1C)=CCC=2.[Y].
What is the InChIKey of 2,3-dimethyl-4,6-dihydrocyclopenta[b]pyridin-4-ide;ethane;yttrium?
The InChIKey is NHKYHWJDUJCVDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N.C2H6.Y/c1-7-6-9-4-3-5-10(9)11-8(7)2;1-2;/h4-5H,3H2,1-2H3;1-2H3;/q-1;;.
What are the key properties of 2,3-dimethyl-4,6-dihydrocyclopenta[b]pyridin-4-ide;ethane;yttrium?
2,3-dimethyl-4,6-dihydrocyclopenta[b]pyridin-4-ide;ethane;yttrium has a molecular weight of 263.17 g/mol, XLogP of 1.49, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-4,6-dihydrocyclopenta[b]pyridin-4-ide;ethane;yttrium is sourced from PubChem (CID 158321972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).