About 5-propan-2-yl-1,2,3,4-tetrahydropyrazine
5-propan-2-yl-1,2,3,4-tetrahydropyrazine (PubChem CID 158322514) has the molecular formula C7H14N2
and a molecular weight of 126.20 g/mol. Its IUPAC name is 5-propan-2-yl-1,2,3,4-tetrahydropyrazine.
Molecular Properties
| Compound Name | 5-propan-2-yl-1,2,3,4-tetrahydropyrazine |
| PubChem CID | 158322514 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | 5-propan-2-yl-1,2,3,4-tetrahydropyrazine |
| SMILES | CC(C)C1=CNCCN1 |
| InChI | InChI=1S/C7H14N2/c1-6(2)7-5-8-3-4-9-7/h5-6,8-9H,3-4H2,1-2H3 |
| InChIKey | IAFUIGWBDOREOT-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-propan-2-yl-1,2,3,4-tetrahydropyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-propan-2-yl-1,2,3,4-tetrahydropyrazine?
The IUPAC name of 5-propan-2-yl-1,2,3,4-tetrahydropyrazine (CID 158322514) is 5-propan-2-yl-1,2,3,4-tetrahydropyrazine.
What is the SMILES notation for 5-propan-2-yl-1,2,3,4-tetrahydropyrazine?
The canonical SMILES for 5-propan-2-yl-1,2,3,4-tetrahydropyrazine is CC(C)C1=CNCCN1.
What is the InChIKey of 5-propan-2-yl-1,2,3,4-tetrahydropyrazine?
The InChIKey is IAFUIGWBDOREOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2/c1-6(2)7-5-8-3-4-9-7/h5-6,8-9H,3-4H2,1-2H3.
What are the key properties of 5-propan-2-yl-1,2,3,4-tetrahydropyrazine?
5-propan-2-yl-1,2,3,4-tetrahydropyrazine has a molecular weight of 126.20 g/mol, XLogP of 0.68, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propan-2-yl-1,2,3,4-tetrahydropyrazine is sourced from PubChem (CID 158322514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).