C22H16BBrF4N2O2 — CID 158322703
2-bromopyridine;(2,4-difluorophenyl)boronic acid;2-(2,4-difluorophenyl)pyridine (PubChem CID 158322703) has the molecular formula C22H16BBrF4N2O2 and a molecular weight of 507.09 g/mol. Its IUPAC name is 2-bromopyridine;(2,4-difluorophenyl)boronic acid;2-(2,4-difluorophenyl)pyridine.
| Compound Name | 2-bromopyridine;(2,4-difluorophenyl)boronic acid;2-(2,4-difluorophenyl)pyridine |
|---|---|
| PubChem CID | 158322703 |
| Molecular Formula | C22H16BBrF4N2O2 |
| Molecular Weight | 507.09 g/mol |
| Exact Mass | 506.04 |
| IUPAC Name | 2-bromopyridine;(2,4-difluorophenyl)boronic acid;2-(2,4-difluorophenyl)pyridine |
| SMILES | Brc1ccccn1.Fc1ccc(-c2ccccn2)c(F)c1.OB(O)c1ccc(F)cc1F |
| InChI | InChI=1S/C11H7F2N.C6H5BF2O2.C5H4BrN/c12-8-4-5-9(10(13)7-8)11-3-1-2-6-14-11;8-4-1-2-5(7(10)11)6(9)3-4;6-5-3-1-2-4-7-5/h1-7H;1-3,10-11H;1-4H |
| InChIKey | GPASCYLIPOENLT-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.09 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|