C26H25ClN4O4 — CID 158323108
3-[2-[1-(4-chlorophenyl)triazol-4-yl]-2-oxoethyl]-8-methyl-7-(1-methylpiperidin-4-yl)oxychromen-2-one (PubChem CID 158323108) has the molecular formula C26H25ClN4O4 and a molecular weight of 492.96 g/mol. Its IUPAC name is 3-[2-[1-(4-chlorophenyl)triazol-4-yl]-2-oxoethyl]-8-methyl-7-(1-methylpiperidin-4-yl)oxychromen-2-one.
| Compound Name | 3-[2-[1-(4-chlorophenyl)triazol-4-yl]-2-oxoethyl]-8-methyl-7-(1-methylpiperidin-4-yl)oxychromen-2-one |
|---|---|
| PubChem CID | 158323108 |
| Molecular Formula | C26H25ClN4O4 |
| Molecular Weight | 492.96 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | 3-[2-[1-(4-chlorophenyl)triazol-4-yl]-2-oxoethyl]-8-methyl-7-(1-methylpiperidin-4-yl)oxychromen-2-one |
| SMILES | Cc1c(OC2CCN(C)CC2)ccc2cc(CC(=O)c3cn(-c4ccc(Cl)cc4)nn3)c(=O)oc12 |
| InChI | InChI=1S/C26H25ClN4O4/c1-16-24(34-21-9-11-30(2)12-10-21)8-3-17-13-18(26(33)35-25(16)17)14-23(32)22-15-31(29-28-22)20-6-4-19(27)5-7-20/h3-8,13,15,21H,9-12,14H2,1-2H3 |
| InChIKey | GPBXHQAKUBEFLV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 90.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.96 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|