C28H53IO5Si2 — CID 158323972
(4R,7R,8S,9E,11S,12S)-4-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-12-[(E)-1-iodoprop-1-en-2-yl]-7,11-dimethyl-7-triethylsilyloxy-1-oxacyclododec-9-en-2-one (PubChem CID 158323972) has the molecular formula C28H53IO5Si2 and a molecular weight of 652.80 g/mol. Its IUPAC name is (4R,7R,8S,9E,11S,12S)-4-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-12-[(E)-1-iodoprop-1-en-2-yl]-7,11-dimethyl-7-triethylsilyloxy-1-oxacyclododec-9-en-2-one.
| Compound Name | (4R,7R,8S,9E,11S,12S)-4-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-12-[(E)-1-iodoprop-1-en-2-yl]-7,11-dimethyl-7-triethylsilyloxy-1-oxacyclododec-9-en-2-one |
|---|---|
| PubChem CID | 158323972 |
| Molecular Formula | C28H53IO5Si2 |
| Molecular Weight | 652.80 g/mol |
| Exact Mass | 652.25 |
| IUPAC Name | (4R,7R,8S,9E,11S,12S)-4-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-12-[(E)-1-iodoprop-1-en-2-yl]-7,11-dimethyl-7-triethylsilyloxy-1-oxacyclododec-9-en-2-one |
| SMILES | CC[Si](CC)(CC)O[C@]1(C)CC[C@@H](O[Si](C)(C)C(C)(C)C)CC(=O)O[C@H](/C(C)=C/I)[C@@H](C)/C=C/[C@@H]1O |
| InChI | InChI=1S/C28H53IO5Si2/c1-12-36(13-2,14-3)34-28(9)18-17-23(33-35(10,11)27(6,7)8)19-25(31)32-26(22(5)20-29)21(4)15-16-24(28)30/h15-16,20-21,23-24,26,30H,12-14,17-19H2,1-11H3/b16-15+,22-20+/t21-,23+,24-,26-,28+/m0/s1 |
| InChIKey | GPEJZNCISHCSSY-PQFZWWCJSA-N |
| XLogP | 8.15 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.80 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|