C19H12N4O2S — CID 158324512
[7-(2-methyl-1,3-benzothiazol-6-yl)-3H-pyrazolo[4,5-f]quinolin-9-yl] formate (PubChem CID 158324512) has the molecular formula C19H12N4O2S and a molecular weight of 360.40 g/mol. Its IUPAC name is [7-(2-methyl-1,3-benzothiazol-6-yl)-3H-pyrazolo[4,5-f]quinolin-9-yl] formate.
| Compound Name | [7-(2-methyl-1,3-benzothiazol-6-yl)-3H-pyrazolo[4,5-f]quinolin-9-yl] formate |
|---|---|
| PubChem CID | 158324512 |
| Molecular Formula | C19H12N4O2S |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | [7-(2-methyl-1,3-benzothiazol-6-yl)-3H-pyrazolo[4,5-f]quinolin-9-yl] formate |
| SMILES | Cc1nc2ccc(-c3cc(OC=O)c4c(ccc5[nH]ncc54)n3)cc2s1 |
| InChI | InChI=1S/C19H12N4O2S/c1-10-21-14-3-2-11(6-18(14)26-10)16-7-17(25-9-24)19-12-8-20-23-13(12)4-5-15(19)22-16/h2-9H,1H3,(H,20,23) |
| InChIKey | HJOAERVGSSMZHP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|