About ethyl 2-[4-cyclopentyl-4-(dimethylamino)-1-(nitromethyl)cyclohexyl]acetate;nitromethane
ethyl 2-[4-cyclopentyl-4-(dimethylamino)-1-(nitromethyl)cyclohexyl]acetate;nitromethane (PubChem CID 158324517) has the molecular formula C19H35N3O6
and a molecular weight of 401.50 g/mol. Its IUPAC name is ethyl 2-[4-cyclopentyl-4-(dimethylamino)-1-(nitromethyl)cyclohexyl]acetate;nitromethane.
Molecular Properties
| Compound Name | ethyl 2-[4-cyclopentyl-4-(dimethylamino)-1-(nitromethyl)cyclohexyl]acetate;nitromethane |
| PubChem CID | 158324517 |
| Molecular Formula | C19H35N3O6 |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.25 |
| IUPAC Name | ethyl 2-[4-cyclopentyl-4-(dimethylamino)-1-(nitromethyl)cyclohexyl]acetate;nitromethane |
| SMILES | CCOC(=O)CC1(C[N+](=O)[O-])CCC(C2CCCC2)(N(C)C)CC1.C[N+](=O)[O-] |
| InChI | InChI=1S/C18H32N2O4.CH3NO2/c1-4-24-16(21)13-17(14-20(22)23)9-11-18(12-10-17,19(2)3)15-7-5-6-8-15;1-2(3)4/h15H,4-14H2,1-3H3;1H3 |
| InChIKey | GPGBEKJYUYKDGC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[4-cyclopentyl-4-(dimethylamino)-1-(nitromethyl)cyclohexyl]acetate;nitromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[4-cyclopentyl-4-(dimethylamino)-1-(nitromethyl)cyclohexyl]acetate;nitromethane?
The IUPAC name of ethyl 2-[4-cyclopentyl-4-(dimethylamino)-1-(nitromethyl)cyclohexyl]acetate;nitromethane (CID 158324517) is ethyl 2-[4-cyclopentyl-4-(dimethylamino)-1-(nitromethyl)cyclohexyl]acetate;nitromethane.
What is the SMILES notation for ethyl 2-[4-cyclopentyl-4-(dimethylamino)-1-(nitromethyl)cyclohexyl]acetate;nitromethane?
The canonical SMILES for ethyl 2-[4-cyclopentyl-4-(dimethylamino)-1-(nitromethyl)cyclohexyl]acetate;nitromethane is CCOC(=O)CC1(C[N+](=O)[O-])CCC(C2CCCC2)(N(C)C)CC1.C[N+](=O)[O-].
What is the InChIKey of ethyl 2-[4-cyclopentyl-4-(dimethylamino)-1-(nitromethyl)cyclohexyl]acetate;nitromethane?
The InChIKey is GPGBEKJYUYKDGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32N2O4.CH3NO2/c1-4-24-16(21)13-17(14-20(22)23)9-11-18(12-10-17,19(2)3)15-7-5-6-8-15;1-2(3)4/h15H,4-14H2,1-3H3;1H3.
What are the key properties of ethyl 2-[4-cyclopentyl-4-(dimethylamino)-1-(nitromethyl)cyclohexyl]acetate;nitromethane?
ethyl 2-[4-cyclopentyl-4-(dimethylamino)-1-(nitromethyl)cyclohexyl]acetate;nitromethane has a molecular weight of 401.50 g/mol, XLogP of 3.16, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[4-cyclopentyl-4-(dimethylamino)-1-(nitromethyl)cyclohexyl]acetate;nitromethane is sourced from PubChem (CID 158324517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).