C31H30ClF3N8O3 — CID 158324580
N-[4-chloro-3-[6-(dimethylamino)-1H-benzimidazol-2-yl]phenyl]-2-methyl-6-(trifluoromethyl)pyridine-3-carboxamide;4-N,4-N-dimethyl-2-nitrobenzene-1,4-diamine (PubChem CID 158324580) has the molecular formula C31H30ClF3N8O3 and a molecular weight of 655.08 g/mol. Its IUPAC name is N-[4-chloro-3-[6-(dimethylamino)-1H-benzimidazol-2-yl]phenyl]-2-methyl-6-(trifluoromethyl)pyridine-3-carboxamide;4-N,4-N-dimethyl-2-nitrobenzene-1,4-diamine.
| Compound Name | N-[4-chloro-3-[6-(dimethylamino)-1H-benzimidazol-2-yl]phenyl]-2-methyl-6-(trifluoromethyl)pyridine-3-carboxamide;4-N,4-N-dimethyl-2-nitrobenzene-1,4-diamine |
|---|---|
| PubChem CID | 158324580 |
| Molecular Formula | C31H30ClF3N8O3 |
| Molecular Weight | 655.08 g/mol |
| Exact Mass | 654.21 |
| IUPAC Name | N-[4-chloro-3-[6-(dimethylamino)-1H-benzimidazol-2-yl]phenyl]-2-methyl-6-(trifluoromethyl)pyridine-3-carboxamide;4-N,4-N-dimethyl-2-nitrobenzene-1,4-diamine |
| SMILES | CN(C)c1ccc(N)c([N+](=O)[O-])c1.Cc1nc(C(F)(F)F)ccc1C(=O)Nc1ccc(Cl)c(-c2nc3ccc(N(C)C)cc3[nH]2)c1 |
| InChI | InChI=1S/C23H19ClF3N5O.C8H11N3O2/c1-12-15(6-9-20(28-12)23(25,26)27)22(33)29-13-4-7-17(24)16(10-13)21-30-18-8-5-14(32(2)3)11-19(18)31-21;1-10(2)6-3-4-7(9)8(5-6)11(12)13/h4-11H,1-3H3,(H,29,33)(H,30,31);3-5H,9H2,1-2H3 |
| InChIKey | GPGGLKXHUPXMPU-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 146.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.08 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|