C18H23F3N2O3 — CID 158324865
2-[1-(2,2-dimethylbutanoyl)indol-3-yl]ethylazanium;2,2,2-trifluoroacetate (PubChem CID 158324865) has the molecular formula C18H23F3N2O3 and a molecular weight of 372.39 g/mol. Its IUPAC name is 2-[1-(2,2-dimethylbutanoyl)indol-3-yl]ethylazanium;2,2,2-trifluoroacetate.
| Compound Name | 2-[1-(2,2-dimethylbutanoyl)indol-3-yl]ethylazanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 158324865 |
| Molecular Formula | C18H23F3N2O3 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 2-[1-(2,2-dimethylbutanoyl)indol-3-yl]ethylazanium;2,2,2-trifluoroacetate |
| SMILES | CCC(C)(C)C(=O)n1cc(CC[NH3+])c2ccccc21.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C16H22N2O.C2HF3O2/c1-4-16(2,3)15(19)18-11-12(9-10-17)13-7-5-6-8-14(13)18;3-2(4,5)1(6)7/h5-8,11H,4,9-10,17H2,1-3H3;(H,6,7) |
| InChIKey | AUGODAKAKVLRQH-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |