About 3-ethyl-2,6-dihydropyrazolo[3,4-c]pyridin-7-one
3-ethyl-2,6-dihydropyrazolo[3,4-c]pyridin-7-one (PubChem CID 15832608) has the molecular formula C8H9N3O
and a molecular weight of 163.18 g/mol. Its IUPAC name is 3-ethyl-2,6-dihydropyrazolo[3,4-c]pyridin-7-one.
Molecular Properties
| Compound Name | 3-ethyl-2,6-dihydropyrazolo[3,4-c]pyridin-7-one |
| PubChem CID | 15832608 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | 3-ethyl-2,6-dihydropyrazolo[3,4-c]pyridin-7-one |
| SMILES | CCc1[nH]nc2c(=O)[nH]ccc12 |
| InChI | InChI=1S/C8H9N3O/c1-2-6-5-3-4-9-8(12)7(5)11-10-6/h3-4H,2H2,1H3,(H,9,12)(H,10,11) |
| InChIKey | XHQPTEZSVPFPNK-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-2,6-dihydropyrazolo[3,4-c]pyridin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2,6-dihydropyrazolo[3,4-c]pyridin-7-one?
The IUPAC name of 3-ethyl-2,6-dihydropyrazolo[3,4-c]pyridin-7-one (CID 15832608) is 3-ethyl-2,6-dihydropyrazolo[3,4-c]pyridin-7-one.
What is the SMILES notation for 3-ethyl-2,6-dihydropyrazolo[3,4-c]pyridin-7-one?
The canonical SMILES for 3-ethyl-2,6-dihydropyrazolo[3,4-c]pyridin-7-one is CCc1[nH]nc2c(=O)[nH]ccc12.
What is the InChIKey of 3-ethyl-2,6-dihydropyrazolo[3,4-c]pyridin-7-one?
The InChIKey is XHQPTEZSVPFPNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O/c1-2-6-5-3-4-9-8(12)7(5)11-10-6/h3-4H,2H2,1H3,(H,9,12)(H,10,11).
What are the key properties of 3-ethyl-2,6-dihydropyrazolo[3,4-c]pyridin-7-one?
3-ethyl-2,6-dihydropyrazolo[3,4-c]pyridin-7-one has a molecular weight of 163.18 g/mol, XLogP of 0.81, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2,6-dihydropyrazolo[3,4-c]pyridin-7-one is sourced from PubChem (CID 15832608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).