C15H12ClN5O — CID 158326180
1-[5-(6-chloro-2-pyridinyl)-1,2,4-oxadiazol-3-yl]-N-[(5-methyl-2-pyridinyl)methyl]methanimine (PubChem CID 158326180) has the molecular formula C15H12ClN5O and a molecular weight of 313.75 g/mol. Its IUPAC name is 1-[5-(6-chloro-2-pyridinyl)-1,2,4-oxadiazol-3-yl]-N-[(5-methyl-2-pyridinyl)methyl]methanimine.
| Compound Name | 1-[5-(6-chloro-2-pyridinyl)-1,2,4-oxadiazol-3-yl]-N-[(5-methyl-2-pyridinyl)methyl]methanimine |
|---|---|
| PubChem CID | 158326180 |
| Molecular Formula | C15H12ClN5O |
| Molecular Weight | 313.75 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 1-[5-(6-chloro-2-pyridinyl)-1,2,4-oxadiazol-3-yl]-N-[(5-methyl-2-pyridinyl)methyl]methanimine |
| SMILES | Cc1ccc(C/N=C/c2noc(-c3cccc(Cl)n3)n2)nc1 |
| InChI | InChI=1S/C15H12ClN5O/c1-10-5-6-11(18-7-10)8-17-9-14-20-15(22-21-14)12-3-2-4-13(16)19-12/h2-7,9H,8H2,1H3/b17-9+ |
| InChIKey | GPKZFCVXQIHGQR-RQZCQDPDSA-N |
| XLogP | 3.11 |
| TPSA | 77.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.75 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|