C18H22O4 — CID 15832627
(11E)-7-methyl-3,9,14-trioxatricyclo[14.4.0.05,7]icosa-1(20),11,16,18-tetraen-4-one (PubChem CID 15832627) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is (11E)-7-methyl-3,9,14-trioxatricyclo[14.4.0.05,7]icosa-1(20),11,16,18-tetraen-4-one.
| Compound Name | (11E)-7-methyl-3,9,14-trioxatricyclo[14.4.0.05,7]icosa-1(20),11,16,18-tetraen-4-one |
|---|---|
| PubChem CID | 15832627 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | (11E)-7-methyl-3,9,14-trioxatricyclo[14.4.0.05,7]icosa-1(20),11,16,18-tetraen-4-one |
| SMILES | CC12COC/C=C/COCc3ccccc3COC(=O)C1C2 |
| InChI | InChI=1S/C18H22O4/c1-18-10-16(18)17(19)22-12-15-7-3-2-6-14(15)11-20-8-4-5-9-21-13-18/h2-7,16H,8-13H2,1H3/b5-4+ |
| InChIKey | BFJNZDUFSJXMRO-SNAWJCMRSA-N |
| XLogP | 2.86 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|