About 1-(2-bromophenyl)-3,4-dimethylphosphole
1-(2-bromophenyl)-3,4-dimethylphosphole (PubChem CID 15832703) has the molecular formula C12H12BrP
and a molecular weight of 267.11 g/mol. Its IUPAC name is 1-(2-bromophenyl)-3,4-dimethylphosphole.
Molecular Properties
| Compound Name | 1-(2-bromophenyl)-3,4-dimethylphosphole |
| PubChem CID | 15832703 |
| Molecular Formula | C12H12BrP |
| Molecular Weight | 267.11 g/mol |
| Exact Mass | 265.99 |
| IUPAC Name | 1-(2-bromophenyl)-3,4-dimethylphosphole |
| SMILES | Cc1cp(-c2ccccc2Br)cc1C |
| InChI | InChI=1S/C12H12BrP/c1-9-7-14(8-10(9)2)12-6-4-3-5-11(12)13/h3-8H,1-2H3 |
| InChIKey | NCXOCXWATUJLOC-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 267.11 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-(2-bromophenyl)-3,4-dimethylphosphole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-bromophenyl)-3,4-dimethylphosphole?
The IUPAC name of 1-(2-bromophenyl)-3,4-dimethylphosphole (CID 15832703) is 1-(2-bromophenyl)-3,4-dimethylphosphole.
What is the SMILES notation for 1-(2-bromophenyl)-3,4-dimethylphosphole?
The canonical SMILES for 1-(2-bromophenyl)-3,4-dimethylphosphole is Cc1cp(-c2ccccc2Br)cc1C.
What is the InChIKey of 1-(2-bromophenyl)-3,4-dimethylphosphole?
The InChIKey is NCXOCXWATUJLOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12BrP/c1-9-7-14(8-10(9)2)12-6-4-3-5-11(12)13/h3-8H,1-2H3.
What are the key properties of 1-(2-bromophenyl)-3,4-dimethylphosphole?
1-(2-bromophenyl)-3,4-dimethylphosphole has a molecular weight of 267.11 g/mol, XLogP of 5.04, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-bromophenyl)-3,4-dimethylphosphole is sourced from PubChem (CID 15832703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).