About 4-methylsulfonyl-2-nitrophenol;4-nitropyridin-3-ol
4-methylsulfonyl-2-nitrophenol;4-nitropyridin-3-ol (PubChem CID 158327037) has the molecular formula C12H11N3O8S
and a molecular weight of 357.30 g/mol. Its IUPAC name is 4-methylsulfonyl-2-nitrophenol;4-nitropyridin-3-ol.
Molecular Properties
| Compound Name | 4-methylsulfonyl-2-nitrophenol;4-nitropyridin-3-ol |
| PubChem CID | 158327037 |
| Molecular Formula | C12H11N3O8S |
| Molecular Weight | 357.30 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | 4-methylsulfonyl-2-nitrophenol;4-nitropyridin-3-ol |
| SMILES | CS(=O)(=O)c1ccc(O)c([N+](=O)[O-])c1.O=[N+]([O-])c1ccncc1O |
| InChI | InChI=1S/C7H7NO5S.C5H4N2O3/c1-14(12,13)5-2-3-7(9)6(4-5)8(10)11;8-5-3-6-2-1-4(5)7(9)10/h2-4,9H,1H3;1-3,8H |
| InChIKey | GPNPOKGTQDEYRW-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 173.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.30 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-methylsulfonyl-2-nitrophenol;4-nitropyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylsulfonyl-2-nitrophenol;4-nitropyridin-3-ol?
The IUPAC name of 4-methylsulfonyl-2-nitrophenol;4-nitropyridin-3-ol (CID 158327037) is 4-methylsulfonyl-2-nitrophenol;4-nitropyridin-3-ol.
What is the SMILES notation for 4-methylsulfonyl-2-nitrophenol;4-nitropyridin-3-ol?
The canonical SMILES for 4-methylsulfonyl-2-nitrophenol;4-nitropyridin-3-ol is CS(=O)(=O)c1ccc(O)c([N+](=O)[O-])c1.O=[N+]([O-])c1ccncc1O.
What is the InChIKey of 4-methylsulfonyl-2-nitrophenol;4-nitropyridin-3-ol?
The InChIKey is GPNPOKGTQDEYRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO5S.C5H4N2O3/c1-14(12,13)5-2-3-7(9)6(4-5)8(10)11;8-5-3-6-2-1-4(5)7(9)10/h2-4,9H,1H3;1-3,8H.
What are the key properties of 4-methylsulfonyl-2-nitrophenol;4-nitropyridin-3-ol?
4-methylsulfonyl-2-nitrophenol;4-nitropyridin-3-ol has a molecular weight of 357.30 g/mol, XLogP of 1.40, 3 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylsulfonyl-2-nitrophenol;4-nitropyridin-3-ol is sourced from PubChem (CID 158327037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).