C40H29N3SSi — CID 158327543
9-[8-(3-trimethylsilylcarbazol-9-yl)dibenzothiophen-2-yl]carbazole-3-carbonitrile (PubChem CID 158327543) has the molecular formula C40H29N3SSi and a molecular weight of 611.85 g/mol. Its IUPAC name is 9-[8-(3-trimethylsilylcarbazol-9-yl)dibenzothiophen-2-yl]carbazole-3-carbonitrile.
| Compound Name | 9-[8-(3-trimethylsilylcarbazol-9-yl)dibenzothiophen-2-yl]carbazole-3-carbonitrile |
|---|---|
| PubChem CID | 158327543 |
| Molecular Formula | C40H29N3SSi |
| Molecular Weight | 611.85 g/mol |
| Exact Mass | 611.19 |
| IUPAC Name | 9-[8-(3-trimethylsilylcarbazol-9-yl)dibenzothiophen-2-yl]carbazole-3-carbonitrile |
| SMILES | C[Si](C)(C)c1ccc2c(c1)c1ccccc1n2-c1ccc2sc3ccc(-n4c5ccccc5c5cc(C#N)ccc54)cc3c2c1 |
| InChI | InChI=1S/C40H29N3SSi/c1-45(2,3)28-15-17-38-32(23-28)30-9-5-7-11-36(30)43(38)27-14-19-40-34(22-27)33-21-26(13-18-39(33)44-40)42-35-10-6-4-8-29(35)31-20-25(24-41)12-16-37(31)42/h4-23H,1-3H3 |
| InChIKey | QLBDYBVLSQQTLS-UHFFFAOYSA-N |
| XLogP | 10.67 |
| TPSA | 33.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.85 |
| LogP ≤ 5 | 10.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|