About 2,2-dicyanoethenyl 2,2-dimethylpropanoate
2,2-dicyanoethenyl 2,2-dimethylpropanoate (PubChem CID 15832786) has the molecular formula C9H10N2O2
and a molecular weight of 178.19 g/mol. Its IUPAC name is 2,2-dicyanoethenyl 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | 2,2-dicyanoethenyl 2,2-dimethylpropanoate |
| PubChem CID | 15832786 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 2,2-dicyanoethenyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC=C(C#N)C#N |
| InChI | InChI=1S/C9H10N2O2/c1-9(2,3)8(12)13-6-7(4-10)5-11/h6H,1-3H3 |
| InChIKey | CKXCGKZYECHVPS-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 73.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dicyanoethenyl 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dicyanoethenyl 2,2-dimethylpropanoate?
The IUPAC name of 2,2-dicyanoethenyl 2,2-dimethylpropanoate (CID 15832786) is 2,2-dicyanoethenyl 2,2-dimethylpropanoate.
What is the SMILES notation for 2,2-dicyanoethenyl 2,2-dimethylpropanoate?
The canonical SMILES for 2,2-dicyanoethenyl 2,2-dimethylpropanoate is CC(C)(C)C(=O)OC=C(C#N)C#N.
What is the InChIKey of 2,2-dicyanoethenyl 2,2-dimethylpropanoate?
The InChIKey is CKXCGKZYECHVPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O2/c1-9(2,3)8(12)13-6-7(4-10)5-11/h6H,1-3H3.
What are the key properties of 2,2-dicyanoethenyl 2,2-dimethylpropanoate?
2,2-dicyanoethenyl 2,2-dimethylpropanoate has a molecular weight of 178.19 g/mol, XLogP of 1.51, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dicyanoethenyl 2,2-dimethylpropanoate is sourced from PubChem (CID 15832786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).