C12H17F3N2O2 — CID 158328063
2-(1,1-difluoroethyl)-2-fluoro-N,N'-bis(prop-2-enyl)butanediamide (PubChem CID 158328063) has the molecular formula C12H17F3N2O2 and a molecular weight of 278.27 g/mol. Its IUPAC name is 2-(1,1-difluoroethyl)-2-fluoro-N,N'-bis(prop-2-enyl)butanediamide.
| Compound Name | 2-(1,1-difluoroethyl)-2-fluoro-N,N'-bis(prop-2-enyl)butanediamide |
|---|---|
| PubChem CID | 158328063 |
| Molecular Formula | C12H17F3N2O2 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 2-(1,1-difluoroethyl)-2-fluoro-N,N'-bis(prop-2-enyl)butanediamide |
| SMILES | C=CCNC(=O)CC(F)(C(=O)NCC=C)C(C)(F)F |
| InChI | InChI=1S/C12H17F3N2O2/c1-4-6-16-9(18)8-12(15,11(3,13)14)10(19)17-7-5-2/h4-5H,1-2,6-8H2,3H3,(H,16,18)(H,17,19) |
| InChIKey | UZPHWAKMHAHITD-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|