About butan-2-ol;butan-2-yl carbonochloridate;butan-2-yl methyl carbonate
butan-2-ol;butan-2-yl carbonochloridate;butan-2-yl methyl carbonate (PubChem CID 158328387) has the molecular formula C15H31ClO6
and a molecular weight of 342.86 g/mol. Its IUPAC name is butan-2-ol;butan-2-yl carbonochloridate;butan-2-yl methyl carbonate.
Molecular Properties
| Compound Name | butan-2-ol;butan-2-yl carbonochloridate;butan-2-yl methyl carbonate |
| PubChem CID | 158328387 |
| Molecular Formula | C15H31ClO6 |
| Molecular Weight | 342.86 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | butan-2-ol;butan-2-yl carbonochloridate;butan-2-yl methyl carbonate |
| SMILES | CCC(C)O.CCC(C)OC(=O)Cl.CCC(C)OC(=O)OC |
| InChI | InChI=1S/C6H12O3.C5H9ClO2.C4H10O/c1-4-5(2)9-6(7)8-3;1-3-4(2)8-5(6)7;1-3-4(2)5/h5H,4H2,1-3H3;4H,3H2,1-2H3;4-5H,3H2,1-2H3 |
| InChIKey | GPRTZTMCHLZHBJ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.86 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze butan-2-ol;butan-2-yl carbonochloridate;butan-2-yl methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-ol;butan-2-yl carbonochloridate;butan-2-yl methyl carbonate?
The IUPAC name of butan-2-ol;butan-2-yl carbonochloridate;butan-2-yl methyl carbonate (CID 158328387) is butan-2-ol;butan-2-yl carbonochloridate;butan-2-yl methyl carbonate.
What is the SMILES notation for butan-2-ol;butan-2-yl carbonochloridate;butan-2-yl methyl carbonate?
The canonical SMILES for butan-2-ol;butan-2-yl carbonochloridate;butan-2-yl methyl carbonate is CCC(C)O.CCC(C)OC(=O)Cl.CCC(C)OC(=O)OC.
What is the InChIKey of butan-2-ol;butan-2-yl carbonochloridate;butan-2-yl methyl carbonate?
The InChIKey is GPRTZTMCHLZHBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O3.C5H9ClO2.C4H10O/c1-4-5(2)9-6(7)8-3;1-3-4(2)8-5(6)7;1-3-4(2)5/h5H,4H2,1-3H3;4H,3H2,1-2H3;4-5H,3H2,1-2H3.
What are the key properties of butan-2-ol;butan-2-yl carbonochloridate;butan-2-yl methyl carbonate?
butan-2-ol;butan-2-yl carbonochloridate;butan-2-yl methyl carbonate has a molecular weight of 342.86 g/mol, XLogP of 4.51, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-ol;butan-2-yl carbonochloridate;butan-2-yl methyl carbonate is sourced from PubChem (CID 158328387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).