C55H76O6P2 — CID 158328556
1-[2-(3,5-dimethoxyphenyl)phenyl]-2,2,6,6-tetramethylphosphinan-4-one;1-[4,5-dimethoxy-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]-2,2,6,6-tetramethylphosphinan-4-one (PubChem CID 158328556) has the molecular formula C55H76O6P2 and a molecular weight of 895.15 g/mol. Its IUPAC name is 1-[2-(3,5-dimethoxyphenyl)phenyl]-2,2,6,6-tetramethylphosphinan-4-one;1-[4,5-dimethoxy-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]-2,2,6,6-tetramethylphosphinan-4-one.
| Compound Name | 1-[2-(3,5-dimethoxyphenyl)phenyl]-2,2,6,6-tetramethylphosphinan-4-one;1-[4,5-dimethoxy-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]-2,2,6,6-tetramethylphosphinan-4-one |
|---|---|
| PubChem CID | 158328556 |
| Molecular Formula | C55H76O6P2 |
| Molecular Weight | 895.15 g/mol |
| Exact Mass | 894.51 |
| IUPAC Name | 1-[2-(3,5-dimethoxyphenyl)phenyl]-2,2,6,6-tetramethylphosphinan-4-one;1-[4,5-dimethoxy-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]-2,2,6,6-tetramethylphosphinan-4-one |
| SMILES | COc1cc(-c2c(C(C)C)cc(C(C)C)cc2C(C)C)c(P2C(C)(C)CC(=O)CC2(C)C)cc1OC.COc1cc(OC)cc(-c2ccccc2P2C(C)(C)CC(=O)CC2(C)C)c1 |
| InChI | InChI=1S/C32H47O3P.C23H29O3P/c1-19(2)22-13-24(20(3)4)30(25(14-22)21(5)6)26-15-27(34-11)28(35-12)16-29(26)36-31(7,8)17-23(33)18-32(36,9)10;1-22(2)14-17(24)15-23(3,4)27(22)21-10-8-7-9-20(21)16-11-18(25-5)13-19(12-16)26-6/h13-16,19-21H,17-18H2,1-12H3;7-13H,14-15H2,1-6H3 |
| InChIKey | GPSHMMIEYRIALO-UHFFFAOYSA-N |
| XLogP | 14.17 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 895.15 |
| LogP ≤ 5 | 14.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|