C31H65IO4Si3 — CID 158328799
tert-butyl-[(E,1S)-1-[(2S,3R,4S,5S,6S)-6-butyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methyloxan-2-yl]-3-iodoprop-2-enoxy]-dimethylsilane (PubChem CID 158328799) has the molecular formula C31H65IO4Si3 and a molecular weight of 713.02 g/mol. Its IUPAC name is tert-butyl-[(E,1S)-1-[(2S,3R,4S,5S,6S)-6-butyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methyloxan-2-yl]-3-iodoprop-2-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E,1S)-1-[(2S,3R,4S,5S,6S)-6-butyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methyloxan-2-yl]-3-iodoprop-2-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 158328799 |
| Molecular Formula | C31H65IO4Si3 |
| Molecular Weight | 713.02 g/mol |
| Exact Mass | 712.32 |
| IUPAC Name | tert-butyl-[(E,1S)-1-[(2S,3R,4S,5S,6S)-6-butyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methyloxan-2-yl]-3-iodoprop-2-enoxy]-dimethylsilane |
| SMILES | CCCC[C@@H]1O[C@@H]([C@H](/C=C/I)O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C |
| InChI | InChI=1S/C31H65IO4Si3/c1-18-19-20-24-23(2)26(35-38(14,15)30(6,7)8)28(36-39(16,17)31(9,10)11)27(33-24)25(21-22-32)34-37(12,13)29(3,4)5/h21-28H,18-20H2,1-17H3/b22-21+/t23-,24-,25-,26-,27-,28-/m0/s1 |
| InChIKey | MPVRKGJRFUEDRR-HVMBRBMHSA-N |
| XLogP | 10.70 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.02 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|