C33H70O4Si4 — CID 158328800
[(E,3S)-3-[(2S,3R,4S,5S,6S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methyl-6-prop-2-enyloxan-2-yl]-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-trimethylsilane (PubChem CID 158328800) has the molecular formula C33H70O4Si4 and a molecular weight of 643.26 g/mol. Its IUPAC name is [(E,3S)-3-[(2S,3R,4S,5S,6S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methyl-6-prop-2-enyloxan-2-yl]-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-trimethylsilane.
| Compound Name | [(E,3S)-3-[(2S,3R,4S,5S,6S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methyl-6-prop-2-enyloxan-2-yl]-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-trimethylsilane |
|---|---|
| PubChem CID | 158328800 |
| Molecular Formula | C33H70O4Si4 |
| Molecular Weight | 643.26 g/mol |
| Exact Mass | 642.44 |
| IUPAC Name | [(E,3S)-3-[(2S,3R,4S,5S,6S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methyl-6-prop-2-enyloxan-2-yl]-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-trimethylsilane |
| SMILES | C=CC[C@@H]1O[C@@H]([C@H](/C=C/[Si](C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C |
| InChI | InChI=1S/C33H70O4Si4/c1-21-22-26-25(2)28(36-40(17,18)32(6,7)8)30(37-41(19,20)33(9,10)11)29(34-26)27(23-24-38(12,13)14)35-39(15,16)31(3,4)5/h21,23-30H,1,22H2,2-20H3/b24-23+/t25-,26-,27-,28-,29-,30-/m0/s1 |
| InChIKey | MQKPNXMQTLFNMY-XIHBPWPISA-N |
| XLogP | 10.57 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.26 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|