C33H72O5Si4 — CID 158328801
3-[(2S,3S,4S,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[(E,1S)-1-[tert-butyl(dimethyl)silyl]oxy-3-trimethylsilylprop-2-enyl]-3-methyloxan-2-yl]propan-1-ol (PubChem CID 158328801) has the molecular formula C33H72O5Si4 and a molecular weight of 661.28 g/mol. Its IUPAC name is 3-[(2S,3S,4S,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[(E,1S)-1-[tert-butyl(dimethyl)silyl]oxy-3-trimethylsilylprop-2-enyl]-3-methyloxan-2-yl]propan-1-ol.
| Compound Name | 3-[(2S,3S,4S,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[(E,1S)-1-[tert-butyl(dimethyl)silyl]oxy-3-trimethylsilylprop-2-enyl]-3-methyloxan-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 158328801 |
| Molecular Formula | C33H72O5Si4 |
| Molecular Weight | 661.28 g/mol |
| Exact Mass | 660.45 |
| IUPAC Name | 3-[(2S,3S,4S,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[(E,1S)-1-[tert-butyl(dimethyl)silyl]oxy-3-trimethylsilylprop-2-enyl]-3-methyloxan-2-yl]propan-1-ol |
| SMILES | C[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]([C@H](/C=C/[Si](C)(C)C)O[Si](C)(C)C(C)(C)C)O[C@H]1CCCO |
| InChI | InChI=1S/C33H72O5Si4/c1-25-26(21-20-23-34)35-29(27(22-24-39(11,12)13)36-40(14,15)31(2,3)4)30(38-42(18,19)33(8,9)10)28(25)37-41(16,17)32(5,6)7/h22,24-30,34H,20-21,23H2,1-19H3/b24-22+/t25-,26-,27-,28-,29-,30-/m0/s1 |
| InChIKey | SGCQYGFUDVXNLK-YBMRKNTLSA-N |
| XLogP | 9.77 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.28 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|