C34H74O4Si4 — CID 158328802
tert-butyl-[(E,1S)-1-[(2S,3R,4S,5S,6S)-6-butyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methyloxan-2-yl]-3-trimethylsilylprop-2-enoxy]-dimethylsilane (PubChem CID 158328802) has the molecular formula C34H74O4Si4 and a molecular weight of 659.31 g/mol. Its IUPAC name is tert-butyl-[(E,1S)-1-[(2S,3R,4S,5S,6S)-6-butyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methyloxan-2-yl]-3-trimethylsilylprop-2-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E,1S)-1-[(2S,3R,4S,5S,6S)-6-butyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methyloxan-2-yl]-3-trimethylsilylprop-2-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 158328802 |
| Molecular Formula | C34H74O4Si4 |
| Molecular Weight | 659.31 g/mol |
| Exact Mass | 658.47 |
| IUPAC Name | tert-butyl-[(E,1S)-1-[(2S,3R,4S,5S,6S)-6-butyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methyloxan-2-yl]-3-trimethylsilylprop-2-enoxy]-dimethylsilane |
| SMILES | CCCC[C@@H]1O[C@@H]([C@H](/C=C/[Si](C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C |
| InChI | InChI=1S/C34H74O4Si4/c1-21-22-23-27-26(2)29(37-41(17,18)33(6,7)8)31(38-42(19,20)34(9,10)11)30(35-27)28(24-25-39(12,13)14)36-40(15,16)32(3,4)5/h24-31H,21-23H2,1-20H3/b25-24+/t26-,27-,28-,29-,30-,31-/m0/s1 |
| InChIKey | GUAQVIBWCBPGDX-KAARUAENSA-N |
| XLogP | 11.18 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.31 |
| LogP ≤ 5 | 11.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|