About sodium;1-hexyl-2,3,3-trimethyl-5H-indol-1-ium-5-ide;sulfur trioxide
sodium;1-hexyl-2,3,3-trimethyl-5H-indol-1-ium-5-ide;sulfur trioxide (PubChem CID 158329027) has the molecular formula C17H25NNaO3S+
and a molecular weight of 346.45 g/mol. Its IUPAC name is sodium;1-hexyl-2,3,3-trimethyl-5H-indol-1-ium-5-ide;sulfur trioxide.
Molecular Properties
| Compound Name | sodium;1-hexyl-2,3,3-trimethyl-5H-indol-1-ium-5-ide;sulfur trioxide |
| PubChem CID | 158329027 |
| Molecular Formula | C17H25NNaO3S+ |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | sodium;1-hexyl-2,3,3-trimethyl-5H-indol-1-ium-5-ide;sulfur trioxide |
| SMILES | CCCCCC[N+]1=C(C)C(C)(C)c2c[c-]ccc21.O=S(=O)=O.[Na+] |
| InChI | InChI=1S/C17H25N.Na.O3S/c1-5-6-7-10-13-18-14(2)17(3,4)15-11-8-9-12-16(15)18;;1-4(2)3/h9,11-12H,5-7,10,13H2,1-4H3;;/q;+1; |
| InChIKey | ZRBWTBCNBCCPSA-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 54.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze sodium;1-hexyl-2,3,3-trimethyl-5H-indol-1-ium-5-ide;sulfur trioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;1-hexyl-2,3,3-trimethyl-5H-indol-1-ium-5-ide;sulfur trioxide?
The IUPAC name of sodium;1-hexyl-2,3,3-trimethyl-5H-indol-1-ium-5-ide;sulfur trioxide (CID 158329027) is sodium;1-hexyl-2,3,3-trimethyl-5H-indol-1-ium-5-ide;sulfur trioxide.
What is the SMILES notation for sodium;1-hexyl-2,3,3-trimethyl-5H-indol-1-ium-5-ide;sulfur trioxide?
The canonical SMILES for sodium;1-hexyl-2,3,3-trimethyl-5H-indol-1-ium-5-ide;sulfur trioxide is CCCCCC[N+]1=C(C)C(C)(C)c2c[c-]ccc21.O=S(=O)=O.[Na+].
What is the InChIKey of sodium;1-hexyl-2,3,3-trimethyl-5H-indol-1-ium-5-ide;sulfur trioxide?
The InChIKey is ZRBWTBCNBCCPSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25N.Na.O3S/c1-5-6-7-10-13-18-14(2)17(3,4)15-11-8-9-12-16(15)18;;1-4(2)3/h9,11-12H,5-7,10,13H2,1-4H3;;/q;+1;.
What are the key properties of sodium;1-hexyl-2,3,3-trimethyl-5H-indol-1-ium-5-ide;sulfur trioxide?
sodium;1-hexyl-2,3,3-trimethyl-5H-indol-1-ium-5-ide;sulfur trioxide has a molecular weight of 346.45 g/mol, XLogP of 0.46, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;1-hexyl-2,3,3-trimethyl-5H-indol-1-ium-5-ide;sulfur trioxide is sourced from PubChem (CID 158329027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).