C34H38Br2O4 — CID 158329234
1-(5-bromopentoxy)-4-phenylmethoxybenzene;1-(3-bromopropoxy)-4-phenylmethoxybenzene (PubChem CID 158329234) has the molecular formula C34H38Br2O4 and a molecular weight of 670.48 g/mol. Its IUPAC name is 1-(5-bromopentoxy)-4-phenylmethoxybenzene;1-(3-bromopropoxy)-4-phenylmethoxybenzene.
| Compound Name | 1-(5-bromopentoxy)-4-phenylmethoxybenzene;1-(3-bromopropoxy)-4-phenylmethoxybenzene |
|---|---|
| PubChem CID | 158329234 |
| Molecular Formula | C34H38Br2O4 |
| Molecular Weight | 670.48 g/mol |
| Exact Mass | 668.11 |
| IUPAC Name | 1-(5-bromopentoxy)-4-phenylmethoxybenzene;1-(3-bromopropoxy)-4-phenylmethoxybenzene |
| SMILES | BrCCCCCOc1ccc(OCc2ccccc2)cc1.BrCCCOc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C18H21BrO2.C16H17BrO2/c19-13-5-2-6-14-20-17-9-11-18(12-10-17)21-15-16-7-3-1-4-8-16;17-11-4-12-18-15-7-9-16(10-8-15)19-13-14-5-2-1-3-6-14/h1,3-4,7-12H,2,5-6,13-15H2;1-3,5-10H,4,11-13H2 |
| InChIKey | GPUKTVHIEJKPMC-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.48 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|