C17H8F8N2 — CID 158329465
4,5,6,7-tetrafluoro-1H-indole;4,5,6,7-tetrafluoro-2-methyl-1H-indole (PubChem CID 158329465) has the molecular formula C17H8F8N2 and a molecular weight of 392.25 g/mol. Its IUPAC name is 4,5,6,7-tetrafluoro-1H-indole;4,5,6,7-tetrafluoro-2-methyl-1H-indole.
| Compound Name | 4,5,6,7-tetrafluoro-1H-indole;4,5,6,7-tetrafluoro-2-methyl-1H-indole |
|---|---|
| PubChem CID | 158329465 |
| Molecular Formula | C17H8F8N2 |
| Molecular Weight | 392.25 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 4,5,6,7-tetrafluoro-1H-indole;4,5,6,7-tetrafluoro-2-methyl-1H-indole |
| SMILES | Cc1cc2c(F)c(F)c(F)c(F)c2[nH]1.Fc1c(F)c(F)c2[nH]ccc2c1F |
| InChI | InChI=1S/C9H5F4N.C8H3F4N/c1-3-2-4-5(10)6(11)7(12)8(13)9(4)14-3;9-4-3-1-2-13-8(3)7(12)6(11)5(4)10/h2,14H,1H3;1-2,13H |
| InChIKey | GPVCTOLFJGNSDQ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.25 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|