About azane;trimethylborane
azane;trimethylborane (PubChem CID 158329576) has the molecular formula C3H12BN
and a molecular weight of 72.95 g/mol. Its IUPAC name is azane;trimethylborane.
Molecular Properties
| Compound Name | azane;trimethylborane |
| PubChem CID | 158329576 |
| Molecular Formula | C3H12BN |
| Molecular Weight | 72.95 g/mol |
| Exact Mass | 73.11 |
| IUPAC Name | azane;trimethylborane |
| SMILES | CB(C)C.N |
| InChI | InChI=1S/C3H9B.H3N/c1-4(2)3;/h1-3H3;1H3 |
| InChIKey | GPVMAMPCGCPARN-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 72.95 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze azane;trimethylborane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;trimethylborane?
The IUPAC name of azane;trimethylborane (CID 158329576) is azane;trimethylborane.
What is the SMILES notation for azane;trimethylborane?
The canonical SMILES for azane;trimethylborane is CB(C)C.N.
What is the InChIKey of azane;trimethylborane?
The InChIKey is GPVMAMPCGCPARN-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9B.H3N/c1-4(2)3;/h1-3H3;1H3.
What are the key properties of azane;trimethylborane?
azane;trimethylborane has a molecular weight of 72.95 g/mol, XLogP of 1.53, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;trimethylborane is sourced from PubChem (CID 158329576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).