C38H54BN4O7 — CID 158329791
CID 158329791 (PubChem CID 158329791) has the molecular formula C38H54BN4O7 and a molecular weight of 689.68 g/mol.
| Compound Name | CID 158329791 |
|---|---|
| PubChem CID | 158329791 |
| Molecular Formula | C38H54BN4O7 |
| Molecular Weight | 689.68 g/mol |
| Exact Mass | 689.41 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]2[C@H](C1)OCC(=O)N2Cc1ccccc1.CC(C)(C)OC(=O)N1CC[C@H]2[C@H](C1)OCCN2Cc1ccccc1.[B] |
| InChI | InChI=1S/C19H26N2O4.C19H28N2O3.B/c1-19(2,3)25-18(23)20-10-9-15-16(12-20)24-13-17(22)21(15)11-14-7-5-4-6-8-14;1-19(2,3)24-18(22)21-10-9-16-17(14-21)23-12-11-20(16)13-15-7-5-4-6-8-15;/h4-8,15-16H,9-13H2,1-3H3;4-8,16-17H,9-14H2,1-3H3;/t15-,16-;16-,17-;/m00./s1 |
| InChIKey | HZVBJGUAZCXPLH-YGPROGCQSA-N |
| XLogP | 4.94 |
| TPSA | 101.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.68 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|