C29H24Cl3N5O4 — CID 158331021
ethyl 6-chloro-4-(3-methylanilino)-1,5-naphthyridine-3-carboxylate;ethyl 4,6-dichloro-1,5-naphthyridine-3-carboxylate (PubChem CID 158331021) has the molecular formula C29H24Cl3N5O4 and a molecular weight of 612.90 g/mol. Its IUPAC name is ethyl 6-chloro-4-(3-methylanilino)-1,5-naphthyridine-3-carboxylate;ethyl 4,6-dichloro-1,5-naphthyridine-3-carboxylate.
| Compound Name | ethyl 6-chloro-4-(3-methylanilino)-1,5-naphthyridine-3-carboxylate;ethyl 4,6-dichloro-1,5-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 158331021 |
| Molecular Formula | C29H24Cl3N5O4 |
| Molecular Weight | 612.90 g/mol |
| Exact Mass | 611.09 |
| IUPAC Name | ethyl 6-chloro-4-(3-methylanilino)-1,5-naphthyridine-3-carboxylate;ethyl 4,6-dichloro-1,5-naphthyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2ccc(Cl)nc2c1Cl.CCOC(=O)c1cnc2ccc(Cl)nc2c1Nc1cccc(C)c1 |
| InChI | InChI=1S/C18H16ClN3O2.C11H8Cl2N2O2/c1-3-24-18(23)13-10-20-14-7-8-15(19)22-17(14)16(13)21-12-6-4-5-11(2)9-12;1-2-17-11(16)6-5-14-7-3-4-8(12)15-10(7)9(6)13/h4-10H,3H2,1-2H3,(H,20,21);3-5H,2H2,1H3 |
| InChIKey | GPZZMIJZBSGEKQ-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 116.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.90 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|