About N,N-dichloroaniline;1H-pyrazole
N,N-dichloroaniline;1H-pyrazole (PubChem CID 158331237) has the molecular formula C9H9Cl2N3
and a molecular weight of 230.10 g/mol. Its IUPAC name is N,N-dichloroaniline;1H-pyrazole.
Molecular Properties
| Compound Name | N,N-dichloroaniline;1H-pyrazole |
| PubChem CID | 158331237 |
| Molecular Formula | C9H9Cl2N3 |
| Molecular Weight | 230.10 g/mol |
| Exact Mass | 229.02 |
| IUPAC Name | N,N-dichloroaniline;1H-pyrazole |
| SMILES | ClN(Cl)c1ccccc1.c1cn[nH]c1 |
| InChI | InChI=1S/C6H5Cl2N.C3H4N2/c7-9(8)6-4-2-1-3-5-6;1-2-4-5-3-1/h1-5H;1-3H,(H,4,5) |
| InChIKey | GQANZZYZYLBBQC-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.10 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N,N-dichloroaniline;1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dichloroaniline;1H-pyrazole?
The IUPAC name of N,N-dichloroaniline;1H-pyrazole (CID 158331237) is N,N-dichloroaniline;1H-pyrazole.
What is the SMILES notation for N,N-dichloroaniline;1H-pyrazole?
The canonical SMILES for N,N-dichloroaniline;1H-pyrazole is ClN(Cl)c1ccccc1.c1cn[nH]c1.
What is the InChIKey of N,N-dichloroaniline;1H-pyrazole?
The InChIKey is GQANZZYZYLBBQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5Cl2N.C3H4N2/c7-9(8)6-4-2-1-3-5-6;1-2-4-5-3-1/h1-5H;1-3H,(H,4,5).
What are the key properties of N,N-dichloroaniline;1H-pyrazole?
N,N-dichloroaniline;1H-pyrazole has a molecular weight of 230.10 g/mol, XLogP of 3.21, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dichloroaniline;1H-pyrazole is sourced from PubChem (CID 158331237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).