C29H39N3O3 — CID 158331411
3-[2-[(1R)-2-methoxycyclopropyl]phenyl]-3-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]prop-1-en-2-ol (PubChem CID 158331411) has the molecular formula C29H39N3O3 and a molecular weight of 477.65 g/mol. Its IUPAC name is 3-[2-[(1R)-2-methoxycyclopropyl]phenyl]-3-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]prop-1-en-2-ol.
| Compound Name | 3-[2-[(1R)-2-methoxycyclopropyl]phenyl]-3-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]prop-1-en-2-ol |
|---|---|
| PubChem CID | 158331411 |
| Molecular Formula | C29H39N3O3 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.30 |
| IUPAC Name | 3-[2-[(1R)-2-methoxycyclopropyl]phenyl]-3-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]prop-1-en-2-ol |
| SMILES | C=C(O)C(c1ccccc1[C@H]1CC1OC)N1CC[C@@H](OCCCCc2ccc3c(n2)NCCC3)C1 |
| InChI | InChI=1S/C29H39N3O3/c1-20(33)28(25-11-4-3-10-24(25)26-18-27(26)34-2)32-16-14-23(19-32)35-17-6-5-9-22-13-12-21-8-7-15-30-29(21)31-22/h3-4,10-13,23,26-28,33H,1,5-9,14-19H2,2H3,(H,30,31)/t23-,26-,27?,28?/m1/s1 |
| InChIKey | SLJPTNARSAWZQP-FNAHZRPXSA-N |
| XLogP | 5.17 |
| TPSA | 66.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|