About [dipropoxyphosphoryl(phenyl)methyl] 2-(2,4-dichlorophenoxy)propanoate
[dipropoxyphosphoryl(phenyl)methyl] 2-(2,4-dichlorophenoxy)propanoate (PubChem CID 15833235) has the molecular formula C22H27Cl2O6P
and a molecular weight of 489.33 g/mol. Its IUPAC name is [dipropoxyphosphoryl(phenyl)methyl] 2-(2,4-dichlorophenoxy)propanoate.
Molecular Properties
| Compound Name | [dipropoxyphosphoryl(phenyl)methyl] 2-(2,4-dichlorophenoxy)propanoate |
| PubChem CID | 15833235 |
| Molecular Formula | C22H27Cl2O6P |
| Molecular Weight | 489.33 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | [dipropoxyphosphoryl(phenyl)methyl] 2-(2,4-dichlorophenoxy)propanoate |
| SMILES | CCCOP(=O)(OCCC)C(OC(=O)C(C)Oc1ccc(Cl)cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C22H27Cl2O6P/c1-4-13-27-31(26,28-14-5-2)22(17-9-7-6-8-10-17)30-21(25)16(3)29-20-12-11-18(23)15-19(20)24/h6-12,15-16,22H,4-5,13-14H2,1-3H3 |
| InChIKey | UKLVAAWYYYPOJB-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 489.33 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [dipropoxyphosphoryl(phenyl)methyl] 2-(2,4-dichlorophenoxy)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [dipropoxyphosphoryl(phenyl)methyl] 2-(2,4-dichlorophenoxy)propanoate?
The IUPAC name of [dipropoxyphosphoryl(phenyl)methyl] 2-(2,4-dichlorophenoxy)propanoate (CID 15833235) is [dipropoxyphosphoryl(phenyl)methyl] 2-(2,4-dichlorophenoxy)propanoate.
What is the SMILES notation for [dipropoxyphosphoryl(phenyl)methyl] 2-(2,4-dichlorophenoxy)propanoate?
The canonical SMILES for [dipropoxyphosphoryl(phenyl)methyl] 2-(2,4-dichlorophenoxy)propanoate is CCCOP(=O)(OCCC)C(OC(=O)C(C)Oc1ccc(Cl)cc1Cl)c1ccccc1.
What is the InChIKey of [dipropoxyphosphoryl(phenyl)methyl] 2-(2,4-dichlorophenoxy)propanoate?
The InChIKey is UKLVAAWYYYPOJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27Cl2O6P/c1-4-13-27-31(26,28-14-5-2)22(17-9-7-6-8-10-17)30-21(25)16(3)29-20-12-11-18(23)15-19(20)24/h6-12,15-16,22H,4-5,13-14H2,1-3H3.
What are the key properties of [dipropoxyphosphoryl(phenyl)methyl] 2-(2,4-dichlorophenoxy)propanoate?
[dipropoxyphosphoryl(phenyl)methyl] 2-(2,4-dichlorophenoxy)propanoate has a molecular weight of 489.33 g/mol, XLogP of 7.05, 12 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [dipropoxyphosphoryl(phenyl)methyl] 2-(2,4-dichlorophenoxy)propanoate is sourced from PubChem (CID 15833235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).