methyl 2-[3-(4-chloro-3-fluorophenyl)cyclobutyl]acetate

C26H28Cl2F2O4 — CID 158333339

IUPACmethyl 2-[3-(4-chloro-3-fluorophenyl)cyclobutyl]acetate
SMILESCOC(=O)CC1CC(c2ccc(Cl)c(F)c2)C1.COC(=O)CC1CC(c2ccc(Cl)c(F)c2)C1
InChIInChI=1S/2C13H14ClFO2/c2*1-17-13(16)6-8-4-10(5-8)9-2-3-11(14)12(15)7-9/h2*2-3,7-8,10H,4-6H2,1H3
InChIKeyGQGVKXRKTMTGTE-UHFFFAOYSA-N
MW513.41 g/mol
LogP7.07
Rot. Bonds6

About methyl 2-[3-(4-chloro-3-fluorophenyl)cyclobutyl]acetate

methyl 2-[3-(4-chloro-3-fluorophenyl)cyclobutyl]acetate (PubChem CID 158333339) has the molecular formula C26H28Cl2F2O4 and a molecular weight of 513.41 g/mol. Its IUPAC name is methyl 2-[3-(4-chloro-3-fluorophenyl)cyclobutyl]acetate.

Molecular Properties

Compound Namemethyl 2-[3-(4-chloro-3-fluorophenyl)cyclobutyl]acetate
PubChem CID158333339
Molecular FormulaC26H28Cl2F2O4
Molecular Weight513.41 g/mol
Exact Mass512.13
IUPAC Namemethyl 2-[3-(4-chloro-3-fluorophenyl)cyclobutyl]acetate
SMILESCOC(=O)CC1CC(c2ccc(Cl)c(F)c2)C1.COC(=O)CC1CC(c2ccc(Cl)c(F)c2)C1
InChIInChI=1S/2C13H14ClFO2/c2*1-17-13(16)6-8-4-10(5-8)9-2-3-11(14)12(15)7-9/h2*2-3,7-8,10H,4-6H2,1H3
InChIKeyGQGVKXRKTMTGTE-UHFFFAOYSA-N
XLogP7.07
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms34
Complexity

Lipinski Rule of Five

2 violations

RuleValue
MW ≤ 500513.41
LogP ≤ 57.07
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 2-[3-(4-chloro-3-fluorophenyl)cyclobutyl]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[3-(4-chloro-3-fluorophenyl)cyclobutyl]acetate?
The IUPAC name of methyl 2-[3-(4-chloro-3-fluorophenyl)cyclobutyl]acetate (CID 158333339) is methyl 2-[3-(4-chloro-3-fluorophenyl)cyclobutyl]acetate.
What is the SMILES notation for methyl 2-[3-(4-chloro-3-fluorophenyl)cyclobutyl]acetate?
The canonical SMILES for methyl 2-[3-(4-chloro-3-fluorophenyl)cyclobutyl]acetate is COC(=O)CC1CC(c2ccc(Cl)c(F)c2)C1.COC(=O)CC1CC(c2ccc(Cl)c(F)c2)C1.
What is the InChIKey of methyl 2-[3-(4-chloro-3-fluorophenyl)cyclobutyl]acetate?
The InChIKey is GQGVKXRKTMTGTE-UHFFFAOYSA-N. The full InChI is InChI=1S/2C13H14ClFO2/c2*1-17-13(16)6-8-4-10(5-8)9-2-3-11(14)12(15)7-9/h2*2-3,7-8,10H,4-6H2,1H3.
What are the key properties of methyl 2-[3-(4-chloro-3-fluorophenyl)cyclobutyl]acetate?
methyl 2-[3-(4-chloro-3-fluorophenyl)cyclobutyl]acetate has a molecular weight of 513.41 g/mol, XLogP of 7.07, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[3-(4-chloro-3-fluorophenyl)cyclobutyl]acetate is sourced from PubChem (CID 158333339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).