About guanidine;hydroxy(oxo)phosphanium
guanidine;hydroxy(oxo)phosphanium (PubChem CID 158333694) has the molecular formula CH7N3O2P+
and a molecular weight of 124.06 g/mol. Its IUPAC name is guanidine;hydroxy(oxo)phosphanium.
Molecular Properties
| Compound Name | guanidine;hydroxy(oxo)phosphanium |
| PubChem CID | 158333694 |
| Molecular Formula | CH7N3O2P+ |
| Molecular Weight | 124.06 g/mol |
| Exact Mass | 124.03 |
| IUPAC Name | guanidine;hydroxy(oxo)phosphanium |
| SMILES | O=[PH+]O.[H]N=C(N)N |
| InChI | InChI=1S/CH5N3.HO2P/c2-1(3)4;1-3-2/h(H5,2,3,4);3H/p+1 |
| InChIKey | NKKJITIDXXPGQK-UHFFFAOYSA-O |
| XLogP | -1.24 |
| TPSA | 113.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.06 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze guanidine;hydroxy(oxo)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of guanidine;hydroxy(oxo)phosphanium?
The IUPAC name of guanidine;hydroxy(oxo)phosphanium (CID 158333694) is guanidine;hydroxy(oxo)phosphanium.
What is the SMILES notation for guanidine;hydroxy(oxo)phosphanium?
The canonical SMILES for guanidine;hydroxy(oxo)phosphanium is O=[PH+]O.[H]N=C(N)N.
What is the InChIKey of guanidine;hydroxy(oxo)phosphanium?
The InChIKey is NKKJITIDXXPGQK-UHFFFAOYSA-O. The full InChI is InChI=1S/CH5N3.HO2P/c2-1(3)4;1-3-2/h(H5,2,3,4);3H/p+1.
What are the key properties of guanidine;hydroxy(oxo)phosphanium?
guanidine;hydroxy(oxo)phosphanium has a molecular weight of 124.06 g/mol, XLogP of -1.24, 0 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for guanidine;hydroxy(oxo)phosphanium is sourced from PubChem (CID 158333694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).