C57H42Br6 — CID 158333751
3,9-dibromo-11,11-dimethylbenzo[a]fluorene;5,9-dibromo-11,11-dimethylbenzo[a]fluorene;2,8-dibromo-11,11-dimethylbenzo[b]fluorene (PubChem CID 158333751) has the molecular formula C57H42Br6 and a molecular weight of 1206.39 g/mol. Its IUPAC name is 3,9-dibromo-11,11-dimethylbenzo[a]fluorene;5,9-dibromo-11,11-dimethylbenzo[a]fluorene;2,8-dibromo-11,11-dimethylbenzo[b]fluorene.
| Compound Name | 3,9-dibromo-11,11-dimethylbenzo[a]fluorene;5,9-dibromo-11,11-dimethylbenzo[a]fluorene;2,8-dibromo-11,11-dimethylbenzo[b]fluorene |
|---|---|
| PubChem CID | 158333751 |
| Molecular Formula | C57H42Br6 |
| Molecular Weight | 1206.39 g/mol |
| Exact Mass | 1199.84 |
| IUPAC Name | 3,9-dibromo-11,11-dimethylbenzo[a]fluorene;5,9-dibromo-11,11-dimethylbenzo[a]fluorene;2,8-dibromo-11,11-dimethylbenzo[b]fluorene |
| SMILES | CC1(C)c2cc(Br)ccc2-c2cc(Br)c3ccccc3c21.CC1(C)c2cc(Br)ccc2-c2cc3ccc(Br)cc3cc21.CC1(C)c2cc(Br)ccc2-c2ccc3cc(Br)ccc3c21 |
| InChI | InChI=1S/3C19H14Br2/c1-19(2)17-10-13(21)5-8-15(17)16-6-3-11-9-12(20)4-7-14(11)18(16)19;1-19(2)17-9-12-7-13(20)4-3-11(12)8-16(17)15-6-5-14(21)10-18(15)19;1-19(2)16-9-11(20)7-8-12(16)15-10-17(21)13-5-3-4-6-14(13)18(15)19/h3*3-10H,1-2H3 |
| InChIKey | GQIFGNRZKYYJFE-UHFFFAOYSA-N |
| XLogP | 20.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1206.39 |
| LogP ≤ 5 | 20.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |