C13H15F7N+ — CID 158335368
triethyl-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]azanium (PubChem CID 158335368) has the molecular formula C13H15F7N+ and a molecular weight of 318.26 g/mol. Its IUPAC name is triethyl-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]azanium.
| Compound Name | triethyl-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]azanium |
|---|---|
| PubChem CID | 158335368 |
| Molecular Formula | C13H15F7N+ |
| Molecular Weight | 318.26 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | triethyl-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]azanium |
| SMILES | CC[N+](CC)(CC)c1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C13H15F7N/c1-4-21(5-2,6-3)12-10(16)8(14)7(13(18,19)20)9(15)11(12)17/h4-6H2,1-3H3/q+1 |
| InChIKey | QQDORDOOLYAJOO-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.26 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|