C27H27ClN4O2S — CID 158335460
1-chloro-6-[4-[(5-cyclohex-2-en-1-ylsulfanyl-4-pyridin-3-yl-1,2,4-triazol-3-yl)methoxy]-2-methylphenyl]hex-5-yn-2-one (PubChem CID 158335460) has the molecular formula C27H27ClN4O2S and a molecular weight of 507.06 g/mol. Its IUPAC name is 1-chloro-6-[4-[(5-cyclohex-2-en-1-ylsulfanyl-4-pyridin-3-yl-1,2,4-triazol-3-yl)methoxy]-2-methylphenyl]hex-5-yn-2-one.
| Compound Name | 1-chloro-6-[4-[(5-cyclohex-2-en-1-ylsulfanyl-4-pyridin-3-yl-1,2,4-triazol-3-yl)methoxy]-2-methylphenyl]hex-5-yn-2-one |
|---|---|
| PubChem CID | 158335460 |
| Molecular Formula | C27H27ClN4O2S |
| Molecular Weight | 507.06 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | 1-chloro-6-[4-[(5-cyclohex-2-en-1-ylsulfanyl-4-pyridin-3-yl-1,2,4-triazol-3-yl)methoxy]-2-methylphenyl]hex-5-yn-2-one |
| SMILES | Cc1cc(OCc2nnc(SC3C=CCCC3)n2-c2cccnc2)ccc1C#CCCC(=O)CCl |
| InChI | InChI=1S/C27H27ClN4O2S/c1-20-16-24(14-13-21(20)8-5-6-10-23(33)17-28)34-19-26-30-31-27(35-25-11-3-2-4-12-25)32(26)22-9-7-15-29-18-22/h3,7,9,11,13-16,18,25H,2,4,6,10,12,17,19H2,1H3 |
| InChIKey | GQNGUZDOHYUNKS-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.06 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|