About N,N-bis(4-oxohex-5-enyl)prop-2-enamide;N-ethyl-N-(5-oxohept-6-enyl)prop-2-enamide
N,N-bis(4-oxohex-5-enyl)prop-2-enamide;N-ethyl-N-(5-oxohept-6-enyl)prop-2-enamide (PubChem CID 158335464) has the molecular formula C27H40N2O5
and a molecular weight of 472.63 g/mol. Its IUPAC name is N,N-bis(4-oxohex-5-enyl)prop-2-enamide;N-ethyl-N-(5-oxohept-6-enyl)prop-2-enamide.
Molecular Properties
| Compound Name | N,N-bis(4-oxohex-5-enyl)prop-2-enamide;N-ethyl-N-(5-oxohept-6-enyl)prop-2-enamide |
| PubChem CID | 158335464 |
| Molecular Formula | C27H40N2O5 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.29 |
| IUPAC Name | N,N-bis(4-oxohex-5-enyl)prop-2-enamide;N-ethyl-N-(5-oxohept-6-enyl)prop-2-enamide |
| SMILES | C=CC(=O)CCCCN(CC)C(=O)C=C.C=CC(=O)CCCN(CCCC(=O)C=C)C(=O)C=C |
| InChI | InChI=1S/C15H21NO3.C12H19NO2/c1-4-13(17)9-7-11-16(15(19)6-3)12-8-10-14(18)5-2;1-4-11(14)9-7-8-10-13(6-3)12(15)5-2/h4-6H,1-3,7-12H2;4-5H,1-2,6-10H2,3H3 |
| InChIKey | GQNHEIOBYQZPQE-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N,N-bis(4-oxohex-5-enyl)prop-2-enamide;N-ethyl-N-(5-oxohept-6-enyl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-bis(4-oxohex-5-enyl)prop-2-enamide;N-ethyl-N-(5-oxohept-6-enyl)prop-2-enamide?
The IUPAC name of N,N-bis(4-oxohex-5-enyl)prop-2-enamide;N-ethyl-N-(5-oxohept-6-enyl)prop-2-enamide (CID 158335464) is N,N-bis(4-oxohex-5-enyl)prop-2-enamide;N-ethyl-N-(5-oxohept-6-enyl)prop-2-enamide.
What is the SMILES notation for N,N-bis(4-oxohex-5-enyl)prop-2-enamide;N-ethyl-N-(5-oxohept-6-enyl)prop-2-enamide?
The canonical SMILES for N,N-bis(4-oxohex-5-enyl)prop-2-enamide;N-ethyl-N-(5-oxohept-6-enyl)prop-2-enamide is C=CC(=O)CCCCN(CC)C(=O)C=C.C=CC(=O)CCCN(CCCC(=O)C=C)C(=O)C=C.
What is the InChIKey of N,N-bis(4-oxohex-5-enyl)prop-2-enamide;N-ethyl-N-(5-oxohept-6-enyl)prop-2-enamide?
The InChIKey is GQNHEIOBYQZPQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO3.C12H19NO2/c1-4-13(17)9-7-11-16(15(19)6-3)12-8-10-14(18)5-2;1-4-11(14)9-7-8-10-13(6-3)12(15)5-2/h4-6H,1-3,7-12H2;4-5H,1-2,6-10H2,3H3.
What are the key properties of N,N-bis(4-oxohex-5-enyl)prop-2-enamide;N-ethyl-N-(5-oxohept-6-enyl)prop-2-enamide?
N,N-bis(4-oxohex-5-enyl)prop-2-enamide;N-ethyl-N-(5-oxohept-6-enyl)prop-2-enamide has a molecular weight of 472.63 g/mol, XLogP of 4.02, 19 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-bis(4-oxohex-5-enyl)prop-2-enamide;N-ethyl-N-(5-oxohept-6-enyl)prop-2-enamide is sourced from PubChem (CID 158335464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).