C17H18BNO3 — CID 158338539
1-(5,6-dimethyl-2-pyridinyl)-2-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)ethanone (PubChem CID 158338539) has the molecular formula C17H18BNO3 and a molecular weight of 295.15 g/mol. Its IUPAC name is 1-(5,6-dimethyl-2-pyridinyl)-2-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)ethanone.
| Compound Name | 1-(5,6-dimethyl-2-pyridinyl)-2-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)ethanone |
|---|---|
| PubChem CID | 158338539 |
| Molecular Formula | C17H18BNO3 |
| Molecular Weight | 295.15 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 1-(5,6-dimethyl-2-pyridinyl)-2-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)ethanone |
| SMILES | Cc1ccc(C(=O)Cc2ccc3c(c2)B(O)OCC3)nc1C |
| InChI | InChI=1S/C17H18BNO3/c1-11-3-6-16(19-12(11)2)17(20)10-13-4-5-14-7-8-22-18(21)15(14)9-13/h3-6,9,21H,7-8,10H2,1-2H3 |
| InChIKey | NMBLHCNPIBSZIU-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.15 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|